C28H28N2O3S — CID 166448863
(1Z)-2-(4-methylphenyl)sulfonyl-1-(3-phenylmethoxypropylidene)-4,9-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 166448863) has the molecular formula C28H28N2O3S and a molecular weight of 472.61 g/mol. Its IUPAC name is (1Z)-2-(4-methylphenyl)sulfonyl-1-(3-phenylmethoxypropylidene)-4,9-dihydro-3H-pyrido[3,4-b]indole.
| Compound Name | (1Z)-2-(4-methylphenyl)sulfonyl-1-(3-phenylmethoxypropylidene)-4,9-dihydro-3H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 166448863 |
| Molecular Formula | C28H28N2O3S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | (1Z)-2-(4-methylphenyl)sulfonyl-1-(3-phenylmethoxypropylidene)-4,9-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3c([nH]c4ccccc34)/C2=C/CCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N2O3S/c1-21-13-15-23(16-14-21)34(31,32)30-18-17-25-24-10-5-6-11-26(24)29-28(25)27(30)12-7-19-33-20-22-8-3-2-4-9-22/h2-6,8-16,29H,7,17-20H2,1H3/b27-12- |
| InChIKey | YOTUQCKWTUPUNJ-PPDIBHTLSA-N |
| XLogP | 5.67 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|