C20H24BrIO4S — CID 166448872
1-[[(1S,3R)-3-(2-bromoethoxy)-4-iodo-1-phenylbutoxy]methylsulfonyl]-4-methylbenzene (PubChem CID 166448872) has the molecular formula C20H24BrIO4S and a molecular weight of 567.28 g/mol. Its IUPAC name is 1-[[(1S,3R)-3-(2-bromoethoxy)-4-iodo-1-phenylbutoxy]methylsulfonyl]-4-methylbenzene.
| Compound Name | 1-[[(1S,3R)-3-(2-bromoethoxy)-4-iodo-1-phenylbutoxy]methylsulfonyl]-4-methylbenzene |
|---|---|
| PubChem CID | 166448872 |
| Molecular Formula | C20H24BrIO4S |
| Molecular Weight | 567.28 g/mol |
| Exact Mass | 565.96 |
| IUPAC Name | 1-[[(1S,3R)-3-(2-bromoethoxy)-4-iodo-1-phenylbutoxy]methylsulfonyl]-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)CO[C@@H](C[C@H](CI)OCCBr)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24BrIO4S/c1-16-7-9-19(10-8-16)27(23,24)15-26-20(17-5-3-2-4-6-17)13-18(14-22)25-12-11-21/h2-10,18,20H,11-15H2,1H3/t18-,20+/m1/s1 |
| InChIKey | NYQNYHGQUHLXMQ-QUCCMNQESA-N |
| XLogP | 5.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.28 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|