C10H14O — CID 166448924
11-oxatricyclo[5.3.1.01,6]undec-6-ene (PubChem CID 166448924) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 11-oxatricyclo[5.3.1.01,6]undec-6-ene.
| Compound Name | 11-oxatricyclo[5.3.1.01,6]undec-6-ene |
|---|---|
| PubChem CID | 166448924 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 11-oxatricyclo[5.3.1.01,6]undec-6-ene |
| SMILES | C1CCC23CCCC(=C2C1)O3 |
| InChI | InChI=1S/C10H14O/c1-2-6-10-7-3-5-9(11-10)8(10)4-1/h1-7H2 |
| InChIKey | RHYBMDYEBQKAAE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |