C11H14F2N2O3S — CID 166448993
5,5-difluoro-3-(methylamino)-5-pyridin-3-ylsulfonylpentan-2-one (PubChem CID 166448993) has the molecular formula C11H14F2N2O3S and a molecular weight of 292.31 g/mol. Its IUPAC name is 5,5-difluoro-3-(methylamino)-5-pyridin-3-ylsulfonylpentan-2-one.
| Compound Name | 5,5-difluoro-3-(methylamino)-5-pyridin-3-ylsulfonylpentan-2-one |
|---|---|
| PubChem CID | 166448993 |
| Molecular Formula | C11H14F2N2O3S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5,5-difluoro-3-(methylamino)-5-pyridin-3-ylsulfonylpentan-2-one |
| SMILES | CNC(CC(F)(F)S(=O)(=O)c1cccnc1)C(C)=O |
| InChI | InChI=1S/C11H14F2N2O3S/c1-8(16)10(14-2)6-11(12,13)19(17,18)9-4-3-5-15-7-9/h3-5,7,10,14H,6H2,1-2H3 |
| InChIKey | FNVHDXFLTPKCBT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |