C18H38OSi — CID 166449030
tert-butyl-dimethyl-[(3S,6R)-3-methylundec-1-en-6-yl]oxysilane (PubChem CID 166449030) has the molecular formula C18H38OSi and a molecular weight of 298.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,6R)-3-methylundec-1-en-6-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S,6R)-3-methylundec-1-en-6-yl]oxysilane |
|---|---|
| PubChem CID | 166449030 |
| Molecular Formula | C18H38OSi |
| Molecular Weight | 298.59 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,6R)-3-methylundec-1-en-6-yl]oxysilane |
| SMILES | C=C[C@@H](C)CC[C@@H](CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38OSi/c1-9-11-12-13-17(15-14-16(3)10-2)19-20(7,8)18(4,5)6/h10,16-17H,2,9,11-15H2,1,3-8H3/t16-,17-/m1/s1 |
| InChIKey | GGYRMKAZYRAFGD-IAGOWNOFSA-N |
| XLogP | 6.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|