C20H28 — CID 166449506
2-[(E)-3,7-dimethylnon-1-en-4,8-diynyl]-1,3,3-trimethylcyclohexene (PubChem CID 166449506) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 2-[(E)-3,7-dimethylnon-1-en-4,8-diynyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(E)-3,7-dimethylnon-1-en-4,8-diynyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 166449506 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 2-[(E)-3,7-dimethylnon-1-en-4,8-diynyl]-1,3,3-trimethylcyclohexene |
| SMILES | C#CC(C)CC#CC(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H28/c1-7-16(2)10-8-11-17(3)13-14-19-18(4)12-9-15-20(19,5)6/h1,13-14,16-17H,9-10,12,15H2,2-6H3/b14-13+ |
| InChIKey | XDUKWTSGTJKKLK-BUHFOSPRSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|