C7H12N2O4S — CID 166451119
(3S)-4-[(3-amino-3-oxopropyl)amino]-4-oxo-3-sulfanylbutanoic acid (PubChem CID 166451119) has the molecular formula C7H12N2O4S and a molecular weight of 220.25 g/mol. Its IUPAC name is (3S)-4-[(3-amino-3-oxopropyl)amino]-4-oxo-3-sulfanylbutanoic acid.
| Compound Name | (3S)-4-[(3-amino-3-oxopropyl)amino]-4-oxo-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 166451119 |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (3S)-4-[(3-amino-3-oxopropyl)amino]-4-oxo-3-sulfanylbutanoic acid |
| SMILES | NC(=O)CCNC(=O)[C@@H](S)CC(=O)O |
| InChI | InChI=1S/C7H12N2O4S/c8-5(10)1-2-9-7(13)4(14)3-6(11)12/h4,14H,1-3H2,(H2,8,10)(H,9,13)(H,11,12)/t4-/m0/s1 |
| InChIKey | AHVNPNZWKXGYQJ-BYPYZUCNSA-N |
| XLogP | -1.25 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|