C25H35N7O6S — CID 166455733
2-[[(Z)-3-amino-2-aminosulfanylbut-2-enoyl]amino]-N-[1-[2-(2-bicyclo[2.2.1]heptanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-methyl-5-oxohexanediamide (PubChem CID 166455733) has the molecular formula C25H35N7O6S and a molecular weight of 561.67 g/mol. Its IUPAC name is 2-[[(Z)-3-amino-2-aminosulfanylbut-2-enoyl]amino]-N-[1-[2-(2-bicyclo[2.2.1]heptanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-methyl-5-oxohexanediamide.
| Compound Name | 2-[[(Z)-3-amino-2-aminosulfanylbut-2-enoyl]amino]-N-[1-[2-(2-bicyclo[2.2.1]heptanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-methyl-5-oxohexanediamide |
|---|---|
| PubChem CID | 166455733 |
| Molecular Formula | C25H35N7O6S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | 2-[[(Z)-3-amino-2-aminosulfanylbut-2-enoyl]amino]-N-[1-[2-(2-bicyclo[2.2.1]heptanylamino)-2-oxoethyl]-2-oxo-3-pyridinyl]-N'-methyl-5-oxohexanediamide |
| SMILES | CNC(=O)C(=O)CCC(NC(=O)/C(SN)=C(\C)N)C(=O)Nc1cccn(CC(=O)NC2CC3CCC2C3)c1=O |
| InChI | InChI=1S/C25H35N7O6S/c1-13(26)21(39-27)24(37)30-16(7-8-19(33)23(36)28-2)22(35)31-17-4-3-9-32(25(17)38)12-20(34)29-18-11-14-5-6-15(18)10-14/h3-4,9,14-16,18H,5-8,10-12,26-27H2,1-2H3,(H,28,36)(H,29,34)(H,30,37)(H,31,35)/b21-13- |
| InChIKey | LFCDFXVQSWHCRZ-BKUYFWCQSA-N |
| XLogP | -0.53 |
| TPSA | 207.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|