C24H18N2O3S — CID 166456975
2,4-bis(phenylmethoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazole (PubChem CID 166456975) has the molecular formula C24H18N2O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 2,4-bis(phenylmethoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazole.
| Compound Name | 2,4-bis(phenylmethoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 166456975 |
| Molecular Formula | C24H18N2O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2,4-bis(phenylmethoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazole |
| SMILES | c1ccc(COc2nc3c(OCc4ccccc4)ccc(-c4nccs4)c3o2)cc1 |
| InChI | InChI=1S/C24H18N2O3S/c1-3-7-17(8-4-1)15-27-20-12-11-19(23-25-13-14-30-23)22-21(20)26-24(29-22)28-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
| InChIKey | VRCNPIKESMTCDF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |