C18H19N3OS — CID 166457847
3-[(2-piperidin-1-yl-1,3-thiazol-5-yl)methyl]-1H-quinolin-2-one (PubChem CID 166457847) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 3-[(2-piperidin-1-yl-1,3-thiazol-5-yl)methyl]-1H-quinolin-2-one.
| Compound Name | 3-[(2-piperidin-1-yl-1,3-thiazol-5-yl)methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 166457847 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 3-[(2-piperidin-1-yl-1,3-thiazol-5-yl)methyl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1Cc1cnc(N2CCCCC2)s1 |
| InChI | InChI=1S/C18H19N3OS/c22-17-14(10-13-6-2-3-7-16(13)20-17)11-15-12-19-18(23-15)21-8-4-1-5-9-21/h2-3,6-7,10,12H,1,4-5,8-9,11H2,(H,20,22) |
| InChIKey | RCKHDTDJQKEBPN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |