C18H24N4O3S — CID 56759152
3-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]-1H-quinolin-2-one (PubChem CID 56759152) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]-1H-quinolin-2-one.
| Compound Name | 3-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 56759152 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1CN1CCN(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C18H24N4O3S/c23-18-16(13-15-5-1-2-6-17(15)19-18)14-20-9-11-22(12-10-20)26(24,25)21-7-3-4-8-21/h1-2,5-6,13H,3-4,7-12,14H2,(H,19,23) |
| InChIKey | MDVLZXLEONLEBL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |