C22H35N3O3S — CID 131941541
1-[(2-cyclopentyloxyphenyl)methyl]-4-piperidin-1-ylsulfonyl-1,4-diazepane (PubChem CID 131941541) has the molecular formula C22H35N3O3S and a molecular weight of 421.61 g/mol. Its IUPAC name is 1-[(2-cyclopentyloxyphenyl)methyl]-4-piperidin-1-ylsulfonyl-1,4-diazepane.
| Compound Name | 1-[(2-cyclopentyloxyphenyl)methyl]-4-piperidin-1-ylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 131941541 |
| Molecular Formula | C22H35N3O3S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 1-[(2-cyclopentyloxyphenyl)methyl]-4-piperidin-1-ylsulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(N1CCCCC1)N1CCCN(Cc2ccccc2OC2CCCC2)CC1 |
| InChI | InChI=1S/C22H35N3O3S/c26-29(27,24-14-6-1-7-15-24)25-16-8-13-23(17-18-25)19-20-9-2-5-12-22(20)28-21-10-3-4-11-21/h2,5,9,12,21H,1,3-4,6-8,10-11,13-19H2 |
| InChIKey | QFMRAMCXHACRPU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |