C17H16BrN3O4S — CID 166464116
7-bromo-2,3-dioxo-N-(4-propylphenyl)-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 166464116) has the molecular formula C17H16BrN3O4S and a molecular weight of 438.30 g/mol. Its IUPAC name is 7-bromo-2,3-dioxo-N-(4-propylphenyl)-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | 7-bromo-2,3-dioxo-N-(4-propylphenyl)-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 166464116 |
| Molecular Formula | C17H16BrN3O4S |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 7-bromo-2,3-dioxo-N-(4-propylphenyl)-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | CCCc1ccc(NS(=O)(=O)c2cc3[nH]c(=O)c(=O)[nH]c3cc2Br)cc1 |
| InChI | InChI=1S/C17H16BrN3O4S/c1-2-3-10-4-6-11(7-5-10)21-26(24,25)15-9-14-13(8-12(15)18)19-16(22)17(23)20-14/h4-9,21H,2-3H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | SQXIDURHPASKGS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|