C19H28 — CID 166467456
2,4,8-trimethyl-7-(3-methylbutyl)-8-prop-2-enylbicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 166467456) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 2,4,8-trimethyl-7-(3-methylbutyl)-8-prop-2-enylbicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 2,4,8-trimethyl-7-(3-methylbutyl)-8-prop-2-enylbicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 166467456 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2,4,8-trimethyl-7-(3-methylbutyl)-8-prop-2-enylbicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | C=CCC1(C)c2c(C)cc(C)cc2C1CCC(C)C |
| InChI | InChI=1S/C19H28/c1-7-10-19(6)17(9-8-13(2)3)16-12-14(4)11-15(5)18(16)19/h7,11-13,17H,1,8-10H2,2-6H3 |
| InChIKey | CSAZSVURTPZENK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|