C8H14F3NO2 — CID 166470940
2-ethoxy-N-methyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 166470940) has the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-ethoxy-N-methyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-ethoxy-N-methyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 166470940 |
| Molecular Formula | C8H14F3NO2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-ethoxy-N-methyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CCOC(C)C(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C8H14F3NO2/c1-4-14-6(2)7(13)12(3)5-8(9,10)11/h6H,4-5H2,1-3H3 |
| InChIKey | PBMVJHANTOQIEY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |