C10H10F11NO4 — CID 134694506
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-bis(2-hydroxyethyl)propanamide (PubChem CID 134694506) has the molecular formula C10H10F11NO4 and a molecular weight of 417.17 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-bis(2-hydroxyethyl)propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-bis(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 134694506 |
| Molecular Formula | C10H10F11NO4 |
| Molecular Weight | 417.17 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-bis(2-hydroxyethyl)propanamide |
| SMILES | O=C(N(CCO)CCO)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F11NO4/c11-6(8(14,15)16,5(25)22(1-3-23)2-4-24)26-10(20,21)7(12,13)9(17,18)19/h23-24H,1-4H2 |
| InChIKey | PNJIUKXQUXOBPM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|