C51H98N2 — CID 166471511
ethene;2-methyl-1,1-bis[(E)-6,10,14,18-tetramethyl-2-methylidenenonadec-5-enyl]hydrazine (PubChem CID 166471511) has the molecular formula C51H98N2 and a molecular weight of 739.36 g/mol. Its IUPAC name is ethene;2-methyl-1,1-bis[(E)-6,10,14,18-tetramethyl-2-methylidenenonadec-5-enyl]hydrazine.
| Compound Name | ethene;2-methyl-1,1-bis[(E)-6,10,14,18-tetramethyl-2-methylidenenonadec-5-enyl]hydrazine |
|---|---|
| PubChem CID | 166471511 |
| Molecular Formula | C51H98N2 |
| Molecular Weight | 739.36 g/mol |
| Exact Mass | 738.77 |
| IUPAC Name | ethene;2-methyl-1,1-bis[(E)-6,10,14,18-tetramethyl-2-methylidenenonadec-5-enyl]hydrazine |
| SMILES | C=C.C=C(CC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)CN(CC(=C)CC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)NC |
| InChI | InChI=1S/C49H94N2.C2H4/c1-40(2)22-14-24-42(5)26-16-28-44(7)30-18-32-46(9)34-20-36-48(11)38-51(50-13)39-49(12)37-21-35-47(10)33-19-31-45(8)29-17-27-43(6)25-15-23-41(3)4;1-2/h34-35,40-45,50H,11-12,14-33,36-39H2,1-10,13H3;1-2H2/b46-34+,47-35+; |
| InChIKey | UTPJQGDNDMDYEQ-NGJXIMRYSA-N |
| XLogP | 16.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.36 |
| LogP ≤ 5 | 16.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|