C9H18NO+ — CID 166473737
(3R,5S)-1,1-dimethyl-5-prop-1-en-2-ylpyrrolidin-1-ium-3-ol (PubChem CID 166473737) has the molecular formula C9H18NO+ and a molecular weight of 156.25 g/mol. Its IUPAC name is (3R,5S)-1,1-dimethyl-5-prop-1-en-2-ylpyrrolidin-1-ium-3-ol.
| Compound Name | (3R,5S)-1,1-dimethyl-5-prop-1-en-2-ylpyrrolidin-1-ium-3-ol |
|---|---|
| PubChem CID | 166473737 |
| Molecular Formula | C9H18NO+ |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | (3R,5S)-1,1-dimethyl-5-prop-1-en-2-ylpyrrolidin-1-ium-3-ol |
| SMILES | C=C(C)[C@@H]1C[C@@H](O)C[N+]1(C)C |
| InChI | InChI=1S/C9H18NO/c1-7(2)9-5-8(11)6-10(9,3)4/h8-9,11H,1,5-6H2,2-4H3/q+1/t8-,9+/m1/s1 |
| InChIKey | CYJCALXDPITRKM-BDAKNGLRSA-N |
| XLogP | 0.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|