C16H17ClFN3O — CID 166476027
7-chloro-N-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-propan-2-ylpyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 166476027) has the molecular formula C16H17ClFN3O and a molecular weight of 321.78 g/mol. Its IUPAC name is 7-chloro-N-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-propan-2-ylpyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 7-chloro-N-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-propan-2-ylpyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166476027 |
| Molecular Formula | C16H17ClFN3O |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 7-chloro-N-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-propan-2-ylpyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | CC(C)n1c(C(=O)NC23CC(F)(C2)C3)cc2ccnc(Cl)c21 |
| InChI | InChI=1S/C16H17ClFN3O/c1-9(2)21-11(5-10-3-4-19-13(17)12(10)21)14(22)20-16-6-15(18,7-16)8-16/h3-5,9H,6-8H2,1-2H3,(H,20,22) |
| InChIKey | ZPVPJQCLBGQKQY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|