C21H29ClFN3O2Si — CID 175851318
7-chloro-3-ethyl-N-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 175851318) has the molecular formula C21H29ClFN3O2Si and a molecular weight of 438.02 g/mol. Its IUPAC name is 7-chloro-3-ethyl-N-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 7-chloro-3-ethyl-N-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175851318 |
| Molecular Formula | C21H29ClFN3O2Si |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 7-chloro-3-ethyl-N-(3-fluoro-1-bicyclo[1.1.1]pentanyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | CCc1c(C(=O)NC23CC(F)(C2)C3)n(COCC[Si](C)(C)C)c2c(Cl)nccc12 |
| InChI | InChI=1S/C21H29ClFN3O2Si/c1-5-14-15-6-7-24-18(22)16(15)26(13-28-8-9-29(2,3)4)17(14)19(27)25-21-10-20(23,11-21)12-21/h6-7H,5,8-13H2,1-4H3,(H,25,27) |
| InChIKey | FKLVLGRQKRJKNS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|