C15H18N2O5 — CID 16647932
3-(2,5-dimethoxyanilino)-1-(2-methoxyethyl)pyrrole-2,5-dione (PubChem CID 16647932) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-(2,5-dimethoxyanilino)-1-(2-methoxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,5-dimethoxyanilino)-1-(2-methoxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 16647932 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-(2,5-dimethoxyanilino)-1-(2-methoxyethyl)pyrrole-2,5-dione |
| SMILES | COCCN1C(=O)C=C(Nc2cc(OC)ccc2OC)C1=O |
| InChI | InChI=1S/C15H18N2O5/c1-20-7-6-17-14(18)9-12(15(17)19)16-11-8-10(21-2)4-5-13(11)22-3/h4-5,8-9,16H,6-7H2,1-3H3 |
| InChIKey | VBGFQRSOFSHUFP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|