About [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate
[3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 166480184) has the molecular formula C12H22O7
and a molecular weight of 278.30 g/mol. Its IUPAC name is [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate |
| PubChem CID | 166480184 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC1CC(O)OC(CO)C1O |
| InChI | InChI=1S/C12H22O7/c1-12(2,3)11(16)18-6-17-7-4-9(14)19-8(5-13)10(7)15/h7-10,13-15H,4-6H2,1-3H3 |
| InChIKey | WJHHODQKJZUCRY-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate?
The IUPAC name of [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate (CID 166480184) is [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate.
What is the SMILES notation for [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate?
The canonical SMILES for [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCOC1CC(O)OC(CO)C1O.
What is the InChIKey of [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate?
The InChIKey is WJHHODQKJZUCRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O7/c1-12(2,3)11(16)18-6-17-7-4-9(14)19-8(5-13)10(7)15/h7-10,13-15H,4-6H2,1-3H3.
What are the key properties of [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate?
[3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate has a molecular weight of 278.30 g/mol, XLogP of -0.62, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 166480184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).