C12H22O7 — CID 166480184
[3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 166480184) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 166480184 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [3,6-dihydroxy-2-(hydroxymethyl)oxan-4-yl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC1CC(O)OC(CO)C1O |
| InChI | InChI=1S/C12H22O7/c1-12(2,3)11(16)18-6-17-7-4-9(14)19-8(5-13)10(7)15/h7-10,13-15H,4-6H2,1-3H3 |
| InChIKey | WJHHODQKJZUCRY-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|