C27H22BClF2N8O3S — CID 166482814
CID 166482814 (PubChem CID 166482814) has the molecular formula C27H22BClF2N8O3S and a molecular weight of 622.85 g/mol.
| Compound Name | CID 166482814 |
|---|---|
| PubChem CID | 166482814 |
| Molecular Formula | C27H22BClF2N8O3S |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | — |
| SMILES | Cc1nsc2ccc(F)cc12.[B]C1(c2c(F)cccc2Cl)NC(=O)Cn2c(C(=O)NCc3nccn3C)nc(NC=O)c21 |
| InChI | InChI=1S/C19H16BClFN7O3.C8H6FNS/c1-28-6-5-23-12(28)7-24-18(32)17-26-16(25-9-30)15-19(20,27-13(31)8-29(15)17)14-10(21)3-2-4-11(14)22;1-5-7-4-6(9)2-3-8(7)11-10-5/h2-6,9H,7-8H2,1H3,(H,24,32)(H,25,30)(H,27,31);2-4H,1H3 |
| InChIKey | WNZIMZNTBWTCFV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|