About [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone
[3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone (PubChem CID 166483329) has the molecular formula C15H15F3N3O2P
and a molecular weight of 357.27 g/mol. Its IUPAC name is [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone.
Molecular Properties
| Compound Name | [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone |
| PubChem CID | 166483329 |
| Molecular Formula | C15H15F3N3O2P |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone |
| SMILES | Nc1cc(C2CCN(C(=O)c3ccc(C(F)(F)F)c(P)c3)C2)no1 |
| InChI | InChI=1S/C15H15F3N3O2P/c16-15(17,18)10-2-1-8(5-12(10)24)14(22)21-4-3-9(7-21)11-6-13(19)23-20-11/h1-2,5-6,9H,3-4,7,19,24H2 |
| InChIKey | NRJBLINVVSMUFC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone?
The IUPAC name of [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone (CID 166483329) is [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone.
What is the SMILES notation for [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone?
The canonical SMILES for [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone is Nc1cc(C2CCN(C(=O)c3ccc(C(F)(F)F)c(P)c3)C2)no1.
What is the InChIKey of [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone?
The InChIKey is NRJBLINVVSMUFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3N3O2P/c16-15(17,18)10-2-1-8(5-12(10)24)14(22)21-4-3-9(7-21)11-6-13(19)23-20-11/h1-2,5-6,9H,3-4,7,19,24H2.
What are the key properties of [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone?
[3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone has a molecular weight of 357.27 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-amino-1,2-oxazol-3-yl)pyrrolidin-1-yl]-[3-phosphanyl-4-(trifluoromethyl)phenyl]methanone is sourced from PubChem (CID 166483329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).