C16H21N4O3S+ — CID 166483236
[4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]phenyl]-hydroxy-methyl-sulfanylazanium (PubChem CID 166483236) has the molecular formula C16H21N4O3S+ and a molecular weight of 349.44 g/mol. Its IUPAC name is [4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]phenyl]-hydroxy-methyl-sulfanylazanium.
| Compound Name | [4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]phenyl]-hydroxy-methyl-sulfanylazanium |
|---|---|
| PubChem CID | 166483236 |
| Molecular Formula | C16H21N4O3S+ |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]phenyl]-hydroxy-methyl-sulfanylazanium |
| SMILES | C[N+](O)(S)c1ccc(C(=O)N2CCC(c3cc(N)on3)CC2)cc1 |
| InChI | InChI=1S/C16H21N4O3S/c1-20(22,24)13-4-2-12(3-5-13)16(21)19-8-6-11(7-9-19)14-10-15(17)23-18-14/h2-5,10-11,22,24H,6-9,17H2,1H3/q+1 |
| InChIKey | GSGJJSCFTSGQBW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|