C15H18ClN3O — CID 166484213
(2R)-2-[6-chloro-1-(cyclopropylamino)-2,7-naphthyridin-4-yl]butan-2-ol (PubChem CID 166484213) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is (2R)-2-[6-chloro-1-(cyclopropylamino)-2,7-naphthyridin-4-yl]butan-2-ol.
| Compound Name | (2R)-2-[6-chloro-1-(cyclopropylamino)-2,7-naphthyridin-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 166484213 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2R)-2-[6-chloro-1-(cyclopropylamino)-2,7-naphthyridin-4-yl]butan-2-ol |
| SMILES | CC[C@@](C)(O)c1cnc(NC2CC2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C15H18ClN3O/c1-3-15(2,20)12-8-18-14(19-9-4-5-9)11-7-17-13(16)6-10(11)12/h6-9,20H,3-5H2,1-2H3,(H,18,19)/t15-/m1/s1 |
| InChIKey | WCPAUVQVKBHRSM-OAHLLOKOSA-N |
| XLogP | 3.47 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|