C18H27ClN2O2 — CID 68966974
ethyl 6-[(4-tert-butylcyclohexyl)amino]-5-chloropyridine-3-carboxylate (PubChem CID 68966974) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is ethyl 6-[(4-tert-butylcyclohexyl)amino]-5-chloropyridine-3-carboxylate.
| Compound Name | ethyl 6-[(4-tert-butylcyclohexyl)amino]-5-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 68966974 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | ethyl 6-[(4-tert-butylcyclohexyl)amino]-5-chloropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC2CCC(C(C)(C)C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H27ClN2O2/c1-5-23-17(22)12-10-15(19)16(20-11-12)21-14-8-6-13(7-9-14)18(2,3)4/h10-11,13-14H,5-9H2,1-4H3,(H,20,21) |
| InChIKey | CNDWMIQCLGOTCG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |