C21H27ClN2O2 — CID 90029440
methyl 3-[(4-tert-butylcyclohexyl)amino]-4-chloroisoquinoline-6-carboxylate (PubChem CID 90029440) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is methyl 3-[(4-tert-butylcyclohexyl)amino]-4-chloroisoquinoline-6-carboxylate.
| Compound Name | methyl 3-[(4-tert-butylcyclohexyl)amino]-4-chloroisoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 90029440 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | methyl 3-[(4-tert-butylcyclohexyl)amino]-4-chloroisoquinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2cnc(NC3CCC(C(C)(C)C)CC3)c(Cl)c2c1 |
| InChI | InChI=1S/C21H27ClN2O2/c1-21(2,3)15-7-9-16(10-8-15)24-19-18(22)17-11-13(20(25)26-4)5-6-14(17)12-23-19/h5-6,11-12,15-16H,7-10H2,1-4H3,(H,23,24) |
| InChIKey | WXGJUYOEKFAZLW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |