C20H25ClN2O2 — CID 90027780
3-[(4-tert-butylcyclohexyl)amino]-4-chloroisoquinoline-6-carboxylic acid (PubChem CID 90027780) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is 3-[(4-tert-butylcyclohexyl)amino]-4-chloroisoquinoline-6-carboxylic acid.
| Compound Name | 3-[(4-tert-butylcyclohexyl)amino]-4-chloroisoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 90027780 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-[(4-tert-butylcyclohexyl)amino]-4-chloroisoquinoline-6-carboxylic acid |
| SMILES | CC(C)(C)C1CCC(Nc2ncc3ccc(C(=O)O)cc3c2Cl)CC1 |
| InChI | InChI=1S/C20H25ClN2O2/c1-20(2,3)14-6-8-15(9-7-14)23-18-17(21)16-10-12(19(24)25)4-5-13(16)11-22-18/h4-5,10-11,14-15H,6-9H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | NFOQVYAGQSVNSE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |