C24H25N7O2S — CID 166485023
6-(1-methylbenzimidazol-4-yl)-5-methylsulfanyl-3-(4-morpholin-4-ylanilino)pyrazine-2-carboxamide (PubChem CID 166485023) has the molecular formula C24H25N7O2S and a molecular weight of 475.58 g/mol. Its IUPAC name is 6-(1-methylbenzimidazol-4-yl)-5-methylsulfanyl-3-(4-morpholin-4-ylanilino)pyrazine-2-carboxamide.
| Compound Name | 6-(1-methylbenzimidazol-4-yl)-5-methylsulfanyl-3-(4-morpholin-4-ylanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 166485023 |
| Molecular Formula | C24H25N7O2S |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 6-(1-methylbenzimidazol-4-yl)-5-methylsulfanyl-3-(4-morpholin-4-ylanilino)pyrazine-2-carboxamide |
| SMILES | CSc1nc(Nc2ccc(N3CCOCC3)cc2)c(C(N)=O)nc1-c1cccc2c1ncn2C |
| InChI | InChI=1S/C24H25N7O2S/c1-30-14-26-19-17(4-3-5-18(19)30)20-24(34-2)29-23(21(28-20)22(25)32)27-15-6-8-16(9-7-15)31-10-12-33-13-11-31/h3-9,14H,10-13H2,1-2H3,(H2,25,32)(H,27,29) |
| InChIKey | VZJMHXXFPPLXSE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|