C24H25ClN8O2 — CID 166484712
6-(7-chloro-1-methylbenzimidazol-4-yl)-5-(methylamino)-3-(4-morpholin-4-ylanilino)pyrazine-2-carboxamide (PubChem CID 166484712) has the molecular formula C24H25ClN8O2 and a molecular weight of 492.97 g/mol. Its IUPAC name is 6-(7-chloro-1-methylbenzimidazol-4-yl)-5-(methylamino)-3-(4-morpholin-4-ylanilino)pyrazine-2-carboxamide.
| Compound Name | 6-(7-chloro-1-methylbenzimidazol-4-yl)-5-(methylamino)-3-(4-morpholin-4-ylanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 166484712 |
| Molecular Formula | C24H25ClN8O2 |
| Molecular Weight | 492.97 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 6-(7-chloro-1-methylbenzimidazol-4-yl)-5-(methylamino)-3-(4-morpholin-4-ylanilino)pyrazine-2-carboxamide |
| SMILES | CNc1nc(Nc2ccc(N3CCOCC3)cc2)c(C(N)=O)nc1-c1ccc(Cl)c2c1ncn2C |
| InChI | InChI=1S/C24H25ClN8O2/c1-27-23-19(16-7-8-17(25)21-18(16)28-13-32(21)2)30-20(22(26)34)24(31-23)29-14-3-5-15(6-4-14)33-9-11-35-12-10-33/h3-8,13H,9-12H2,1-2H3,(H2,26,34)(H2,27,29,31) |
| InChIKey | VKRDCSBCYKTRAM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.97 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|