C22H23N7OS — CID 172735668
5-(3-methylimidazo[4,5-c]pyridin-7-yl)-6-methylsulfanyl-N-(4-morpholin-4-ylphenyl)pyrazin-2-amine (PubChem CID 172735668) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is 5-(3-methylimidazo[4,5-c]pyridin-7-yl)-6-methylsulfanyl-N-(4-morpholin-4-ylphenyl)pyrazin-2-amine.
| Compound Name | 5-(3-methylimidazo[4,5-c]pyridin-7-yl)-6-methylsulfanyl-N-(4-morpholin-4-ylphenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 172735668 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 5-(3-methylimidazo[4,5-c]pyridin-7-yl)-6-methylsulfanyl-N-(4-morpholin-4-ylphenyl)pyrazin-2-amine |
| SMILES | CSc1nc(Nc2ccc(N3CCOCC3)cc2)cnc1-c1cncc2c1ncn2C |
| InChI | InChI=1S/C22H23N7OS/c1-28-14-25-20-17(11-23-12-18(20)28)21-22(31-2)27-19(13-24-21)26-15-3-5-16(6-4-15)29-7-9-30-10-8-29/h3-6,11-14H,7-10H2,1-2H3,(H,26,27) |
| InChIKey | IJYYGHJQUNEBIO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|