C19H8F4N4O5 — CID 166491815
6-nitro-2-[2,3,5,6-tetrafluoro-4-(4-nitrophenoxy)phenyl]-1H-benzimidazole (PubChem CID 166491815) has the molecular formula C19H8F4N4O5 and a molecular weight of 448.29 g/mol. Its IUPAC name is 6-nitro-2-[2,3,5,6-tetrafluoro-4-(4-nitrophenoxy)phenyl]-1H-benzimidazole.
| Compound Name | 6-nitro-2-[2,3,5,6-tetrafluoro-4-(4-nitrophenoxy)phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 166491815 |
| Molecular Formula | C19H8F4N4O5 |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 6-nitro-2-[2,3,5,6-tetrafluoro-4-(4-nitrophenoxy)phenyl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc(Oc2c(F)c(F)c(-c3nc4ccc([N+](=O)[O-])cc4[nH]3)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H8F4N4O5/c20-14-13(19-24-11-6-3-9(27(30)31)7-12(11)25-19)15(21)17(23)18(16(14)22)32-10-4-1-8(2-5-10)26(28)29/h1-7H,(H,24,25) |
| InChIKey | HVDITPPURJQJQA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|