C21H24BF3NO4 — CID 166493171
CID 166493171 (PubChem CID 166493171) has the molecular formula C21H24BF3NO4 and a molecular weight of 422.23 g/mol.
| Compound Name | CID 166493171 |
|---|---|
| PubChem CID | 166493171 |
| Molecular Formula | C21H24BF3NO4 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | — |
| SMILES | COC(=O)c1ccc(Nc2cccc(C(F)(F)F)c2)c([B]OC(C)(C)C(C)(C)O)c1 |
| InChI | InChI=1S/C21H24BF3NO4/c1-19(2,28)20(3,4)30-22-16-11-13(18(27)29-5)9-10-17(16)26-15-8-6-7-14(12-15)21(23,24)25/h6-12,26,28H,1-5H3 |
| InChIKey | AZAIXCNTAIYPNL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|