C17H18BrClFN3O3S — CID 166493197
N-[4-bromo-3-[(dimethylamino)methylsulfamoyl]phenyl]-2-(2-chloro-4-fluorophenyl)acetamide (PubChem CID 166493197) has the molecular formula C17H18BrClFN3O3S and a molecular weight of 478.77 g/mol. Its IUPAC name is N-[4-bromo-3-[(dimethylamino)methylsulfamoyl]phenyl]-2-(2-chloro-4-fluorophenyl)acetamide.
| Compound Name | N-[4-bromo-3-[(dimethylamino)methylsulfamoyl]phenyl]-2-(2-chloro-4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 166493197 |
| Molecular Formula | C17H18BrClFN3O3S |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | N-[4-bromo-3-[(dimethylamino)methylsulfamoyl]phenyl]-2-(2-chloro-4-fluorophenyl)acetamide |
| SMILES | CN(C)CNS(=O)(=O)c1cc(NC(=O)Cc2ccc(F)cc2Cl)ccc1Br |
| InChI | InChI=1S/C17H18BrClFN3O3S/c1-23(2)10-21-27(25,26)16-9-13(5-6-14(16)18)22-17(24)7-11-3-4-12(20)8-15(11)19/h3-6,8-9,21H,7,10H2,1-2H3,(H,22,24) |
| InChIKey | VIFDFTAQFORLKZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|