C11H15FN6O2S — CID 166493211
5-amino-N-[(dimethylamino)methyl]-2-(4-fluoropyrazol-1-yl)pyridine-3-sulfonamide (PubChem CID 166493211) has the molecular formula C11H15FN6O2S and a molecular weight of 314.35 g/mol. Its IUPAC name is 5-amino-N-[(dimethylamino)methyl]-2-(4-fluoropyrazol-1-yl)pyridine-3-sulfonamide.
| Compound Name | 5-amino-N-[(dimethylamino)methyl]-2-(4-fluoropyrazol-1-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 166493211 |
| Molecular Formula | C11H15FN6O2S |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 5-amino-N-[(dimethylamino)methyl]-2-(4-fluoropyrazol-1-yl)pyridine-3-sulfonamide |
| SMILES | CN(C)CNS(=O)(=O)c1cc(N)cnc1-n1cc(F)cn1 |
| InChI | InChI=1S/C11H15FN6O2S/c1-17(2)7-16-21(19,20)10-3-9(13)5-14-11(10)18-6-8(12)4-15-18/h3-6,16H,7,13H2,1-2H3 |
| InChIKey | HMCAIXRYYVGVOU-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|