C49H42GeN4O — CID 166497139
9-pyridin-2-yl-2-[3-[3-(1,1,4,4-tetramethyl-7-phenyl-2,3-dihydro-1-benzogermin-8-yl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole (PubChem CID 166497139) has the molecular formula C49H42GeN4O and a molecular weight of 775.51 g/mol. Its IUPAC name is 9-pyridin-2-yl-2-[3-[3-(1,1,4,4-tetramethyl-7-phenyl-2,3-dihydro-1-benzogermin-8-yl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole.
| Compound Name | 9-pyridin-2-yl-2-[3-[3-(1,1,4,4-tetramethyl-7-phenyl-2,3-dihydro-1-benzogermin-8-yl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole |
|---|---|
| PubChem CID | 166497139 |
| Molecular Formula | C49H42GeN4O |
| Molecular Weight | 775.51 g/mol |
| Exact Mass | 776.26 |
| IUPAC Name | 9-pyridin-2-yl-2-[3-[3-(1,1,4,4-tetramethyl-7-phenyl-2,3-dihydro-1-benzogermin-8-yl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole |
| SMILES | CC1(C)CC[Ge](C)(C)c2c1ccc(-c1ccccc1)c2-[n+]1[c-]n(-c2cccc(Oc3ccc4c5ccccc5n(-c5ccccn5)c4c3)c2)c2ccccc21 |
| InChI | InChI=1S/C49H42GeN4O/c1-49(2)28-29-50(3,4)47-41(49)27-26-38(34-15-6-5-7-16-34)48(47)53-33-52(43-21-10-11-22-44(43)53)35-17-14-18-36(31-35)55-37-24-25-40-39-19-8-9-20-42(39)54(45(40)32-37)46-23-12-13-30-51-46/h5-27,30-32H,28-29H2,1-4H3 |
| InChIKey | VSVAEROTFQNOGH-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.51 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|