C10H19N3O — CID 166497205
2-amino-3,5-di(propan-2-yl)-1,2-dihydropyrimidin-6-one (PubChem CID 166497205) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-amino-3,5-di(propan-2-yl)-1,2-dihydropyrimidin-6-one.
| Compound Name | 2-amino-3,5-di(propan-2-yl)-1,2-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 166497205 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-amino-3,5-di(propan-2-yl)-1,2-dihydropyrimidin-6-one |
| SMILES | CC(C)C1=CN(C(C)C)C(N)NC1=O |
| InChI | InChI=1S/C10H19N3O/c1-6(2)8-5-13(7(3)4)10(11)12-9(8)14/h5-7,10H,11H2,1-4H3,(H,12,14) |
| InChIKey | NOTRDJVEZGBDAF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |