C9H12N4O2 — CID 170239987
2-hydroxy-1-propan-2-yl-2,3-dihydropteridin-4-one (PubChem CID 170239987) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-hydroxy-1-propan-2-yl-2,3-dihydropteridin-4-one.
| Compound Name | 2-hydroxy-1-propan-2-yl-2,3-dihydropteridin-4-one |
|---|---|
| PubChem CID | 170239987 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-hydroxy-1-propan-2-yl-2,3-dihydropteridin-4-one |
| SMILES | CC(C)N1c2nccnc2C(=O)NC1O |
| InChI | InChI=1S/C9H12N4O2/c1-5(2)13-7-6(10-3-4-11-7)8(14)12-9(13)15/h3-5,9,15H,1-2H3,(H,12,14) |
| InChIKey | KISKPTVSDFEWGJ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |