About 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one
2-amino-1-(methylamino)-2,3-dihydropteridin-4-one (PubChem CID 141496600) has the molecular formula C7H10N6O
and a molecular weight of 194.20 g/mol. Its IUPAC name is 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one.
Molecular Properties
| Compound Name | 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one |
| PubChem CID | 141496600 |
| Molecular Formula | C7H10N6O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one |
| SMILES | CNN1c2nccnc2C(=O)NC1N |
| InChI | InChI=1S/C7H10N6O/c1-9-13-5-4(10-2-3-11-5)6(14)12-7(13)8/h2-3,7,9H,8H2,1H3,(H,12,14) |
| InChIKey | AAOYAOILHHFRAY-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one?
The IUPAC name of 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one (CID 141496600) is 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one.
What is the SMILES notation for 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one?
The canonical SMILES for 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one is CNN1c2nccnc2C(=O)NC1N.
What is the InChIKey of 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one?
The InChIKey is AAOYAOILHHFRAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6O/c1-9-13-5-4(10-2-3-11-5)6(14)12-7(13)8/h2-3,7,9H,8H2,1H3,(H,12,14).
What are the key properties of 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one?
2-amino-1-(methylamino)-2,3-dihydropteridin-4-one has a molecular weight of 194.20 g/mol, XLogP of -1.60, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(methylamino)-2,3-dihydropteridin-4-one is sourced from PubChem (CID 141496600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).