C7H12N2O2 — CID 163645957
3-ethyl-2-hydroxy-5-methyl-1,2-dihydropyrimidin-6-one (PubChem CID 163645957) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 3-ethyl-2-hydroxy-5-methyl-1,2-dihydropyrimidin-6-one.
| Compound Name | 3-ethyl-2-hydroxy-5-methyl-1,2-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 163645957 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 3-ethyl-2-hydroxy-5-methyl-1,2-dihydropyrimidin-6-one |
| SMILES | CCN1C=C(C)C(=O)NC1O |
| InChI | InChI=1S/C7H12N2O2/c1-3-9-4-5(2)6(10)8-7(9)11/h4,7,11H,3H2,1-2H3,(H,8,10) |
| InChIKey | IIFRKSJALGCYGF-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |