C9H16N2O2 — CID 90854752
2-hydroxy-3-pentan-3-yl-1,2-dihydropyrimidin-6-one (PubChem CID 90854752) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-hydroxy-3-pentan-3-yl-1,2-dihydropyrimidin-6-one.
| Compound Name | 2-hydroxy-3-pentan-3-yl-1,2-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 90854752 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 2-hydroxy-3-pentan-3-yl-1,2-dihydropyrimidin-6-one |
| SMILES | CCC(CC)N1C=CC(=O)NC1O |
| InChI | InChI=1S/C9H16N2O2/c1-3-7(4-2)11-6-5-8(12)10-9(11)13/h5-7,9,13H,3-4H2,1-2H3,(H,10,12) |
| InChIKey | ALJCZATZDZVJKJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |