C7H12N2OS — CID 170142672
3-ethyl-2-hydroxy-5-methyl-1,2-dihydropyrimidine-6-thione (PubChem CID 170142672) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is 3-ethyl-2-hydroxy-5-methyl-1,2-dihydropyrimidine-6-thione.
| Compound Name | 3-ethyl-2-hydroxy-5-methyl-1,2-dihydropyrimidine-6-thione |
|---|---|
| PubChem CID | 170142672 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3-ethyl-2-hydroxy-5-methyl-1,2-dihydropyrimidine-6-thione |
| SMILES | CCN1C=C(C)C(=S)NC1O |
| InChI | InChI=1S/C7H12N2OS/c1-3-9-4-5(2)6(11)8-7(9)10/h4,7,10H,3H2,1-2H3,(H,8,11) |
| InChIKey | MMPPEJINZBJNMA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|