C31H36IO5+ — CID 166512297
(4-tert-butylphenyl)-[2-methyl-4-[[4-[2-(oxan-2-yloxy)-2-oxoethoxy]phenyl]methoxy]phenyl]iodanium (PubChem CID 166512297) has the molecular formula C31H36IO5+ and a molecular weight of 615.53 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[2-methyl-4-[[4-[2-(oxan-2-yloxy)-2-oxoethoxy]phenyl]methoxy]phenyl]iodanium.
| Compound Name | (4-tert-butylphenyl)-[2-methyl-4-[[4-[2-(oxan-2-yloxy)-2-oxoethoxy]phenyl]methoxy]phenyl]iodanium |
|---|---|
| PubChem CID | 166512297 |
| Molecular Formula | C31H36IO5+ |
| Molecular Weight | 615.53 g/mol |
| Exact Mass | 615.16 |
| IUPAC Name | (4-tert-butylphenyl)-[2-methyl-4-[[4-[2-(oxan-2-yloxy)-2-oxoethoxy]phenyl]methoxy]phenyl]iodanium |
| SMILES | Cc1cc(OCc2ccc(OCC(=O)OC3CCCCO3)cc2)ccc1[I+]c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H36IO5/c1-22-19-27(16-17-28(22)32-25-12-10-24(11-13-25)31(2,3)4)35-20-23-8-14-26(15-9-23)36-21-29(33)37-30-7-5-6-18-34-30/h8-17,19,30H,5-7,18,20-21H2,1-4H3/q+1 |
| InChIKey | SKDDUHNEHXBDJQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|