C23H30O4 — CID 54240973
2-[3-methoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane (PubChem CID 54240973) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-[3-methoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane.
| Compound Name | 2-[3-methoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane |
|---|---|
| PubChem CID | 54240973 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-[3-methoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane |
| SMILES | COC(C)(CCOC1CCCCO1)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H30O4/c1-23(24-2,14-16-26-22-13-6-7-15-25-22)20-11-8-12-21(17-20)27-18-19-9-4-3-5-10-19/h3-5,8-12,17,22H,6-7,13-16,18H2,1-2H3 |
| InChIKey | FHQCEHQSYBCUIE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |