C24H32O5 — CID 19761549
2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane (PubChem CID 19761549) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane.
| Compound Name | 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane |
|---|---|
| PubChem CID | 19761549 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane |
| SMILES | COCC(CCOC1CCCCO1)(OC)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H32O5/c1-25-19-24(26-2,14-16-28-23-13-6-7-15-27-23)21-11-8-12-22(17-21)29-18-20-9-4-3-5-10-20/h3-5,8-12,17,23H,6-7,13-16,18-19H2,1-2H3 |
| InChIKey | PWSDAWLOQWHHMN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |