About 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane
2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane (PubChem CID 19761549) has the molecular formula C24H32O5
and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane.
Molecular Properties
| Compound Name | 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane |
| PubChem CID | 19761549 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane |
| SMILES | COCC(CCOC1CCCCO1)(OC)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H32O5/c1-25-19-24(26-2,14-16-28-23-13-6-7-15-27-23)21-11-8-12-22(17-21)29-18-20-9-4-3-5-10-20/h3-5,8-12,17,23H,6-7,13-16,18-19H2,1-2H3 |
| InChIKey | PWSDAWLOQWHHMN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane?
The IUPAC name of 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane (CID 19761549) is 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane.
What is the SMILES notation for 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane?
The canonical SMILES for 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane is COCC(CCOC1CCCCO1)(OC)c1cccc(OCc2ccccc2)c1.
What is the InChIKey of 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane?
The InChIKey is PWSDAWLOQWHHMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32O5/c1-25-19-24(26-2,14-16-28-23-13-6-7-15-27-23)21-11-8-12-22(17-21)29-18-20-9-4-3-5-10-20/h3-5,8-12,17,23H,6-7,13-16,18-19H2,1-2H3.
What are the key properties of 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane?
2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane has a molecular weight of 400.52 g/mol, XLogP of 4.69, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-dimethoxy-3-(3-phenylmethoxyphenyl)butoxy]oxane is sourced from PubChem (CID 19761549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).