C19H36N2O2 — CID 166514816
2-ethylhexanoate;3-(2,4,4-trimethylpentan-2-yl)-1H-imidazol-3-ium (PubChem CID 166514816) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 2-ethylhexanoate;3-(2,4,4-trimethylpentan-2-yl)-1H-imidazol-3-ium.
| Compound Name | 2-ethylhexanoate;3-(2,4,4-trimethylpentan-2-yl)-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 166514816 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 2-ethylhexanoate;3-(2,4,4-trimethylpentan-2-yl)-1H-imidazol-3-ium |
| SMILES | CC(C)(C)CC(C)(C)[n+]1cc[nH]c1.CCCCC(CC)C(=O)[O-] |
| InChI | InChI=1S/C11H20N2.C8H16O2/c1-10(2,3)8-11(4,5)13-7-6-12-9-13;1-3-5-6-7(4-2)8(9)10/h6-7,9H,8H2,1-5H3;7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | NKDZCQCZAKFOOB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|