C22H39NO — CID 166515126
(Z,2E)-N,2-di(ethylidene)octadec-9-enamide (PubChem CID 166515126) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is (Z,2E)-N,2-di(ethylidene)octadec-9-enamide.
| Compound Name | (Z,2E)-N,2-di(ethylidene)octadec-9-enamide |
|---|---|
| PubChem CID | 166515126 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | (Z,2E)-N,2-di(ethylidene)octadec-9-enamide |
| SMILES | C/C=N/C(=O)/C(=C/C)CCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C22H39NO/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(5-2)22(24)23-6-3/h5-6,13-14H,4,7-12,15-20H2,1-3H3/b14-13-,21-5+,23-6+ |
| InChIKey | WDVDQVLKATZKNZ-LQXXZEPOSA-N |
| XLogP | 7.20 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|