C26H47NO — CID 166515127
(Z,2E)-N,2-di(ethylidene)docos-13-enamide (PubChem CID 166515127) has the molecular formula C26H47NO and a molecular weight of 389.67 g/mol. Its IUPAC name is (Z,2E)-N,2-di(ethylidene)docos-13-enamide.
| Compound Name | (Z,2E)-N,2-di(ethylidene)docos-13-enamide |
|---|---|
| PubChem CID | 166515127 |
| Molecular Formula | C26H47NO |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 389.37 |
| IUPAC Name | (Z,2E)-N,2-di(ethylidene)docos-13-enamide |
| SMILES | C/C=N/C(=O)/C(=C/C)CCCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C26H47NO/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(5-2)26(28)27-6-3/h5-6,13-14H,4,7-12,15-24H2,1-3H3/b14-13-,25-5+,27-6+ |
| InChIKey | QSEIEEFJVGDZCZ-RPDKNYIISA-N |
| XLogP | 8.76 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|