C24H45NO — CID 166515129
(2E)-N,2-di(propylidene)octadecanamide (PubChem CID 166515129) has the molecular formula C24H45NO and a molecular weight of 363.63 g/mol. Its IUPAC name is (2E)-N,2-di(propylidene)octadecanamide.
| Compound Name | (2E)-N,2-di(propylidene)octadecanamide |
|---|---|
| PubChem CID | 166515129 |
| Molecular Formula | C24H45NO |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.35 |
| IUPAC Name | (2E)-N,2-di(propylidene)octadecanamide |
| SMILES | CC/C=N/C(=O)/C(=C/CC)CCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C24H45NO/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-21-23(20-5-2)24(26)25-22-6-3/h20,22H,4-19,21H2,1-3H3/b23-20+,25-22+ |
| InChIKey | LJDBESVFRCEGTK-KSTRFRPASA-N |
| XLogP | 8.20 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|